C11H11NOS — CID 102155005
5-methyl-4-methylidene-3-phenyl-1,3-oxazolidine-2-thione (PubChem CID 102155005) has the molecular formula C11H11NOS and a molecular weight of 205.28 g/mol. Its IUPAC name is 5-methyl-4-methylidene-3-phenyl-1,3-oxazolidine-2-thione.
| Compound Name | 5-methyl-4-methylidene-3-phenyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 102155005 |
| Molecular Formula | C11H11NOS |
| Molecular Weight | 205.28 g/mol |
| Exact Mass | 205.06 |
| IUPAC Name | 5-methyl-4-methylidene-3-phenyl-1,3-oxazolidine-2-thione |
| SMILES | C=C1C(C)OC(=S)N1c1ccccc1 |
| InChI | InChI=1S/C11H11NOS/c1-8-9(2)13-11(14)12(8)10-6-4-3-5-7-10/h3-7,9H,1H2,2H3 |
| InChIKey | SIGVCDHUPZOMRZ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.28 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|