C13H15NOS — CID 11831342
(3aS,7aR)-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-2-thione (PubChem CID 11831342) has the molecular formula C13H15NOS and a molecular weight of 233.34 g/mol. Its IUPAC name is (3aS,7aR)-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-2-thione.
| Compound Name | (3aS,7aR)-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 11831342 |
| Molecular Formula | C13H15NOS |
| Molecular Weight | 233.34 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | (3aS,7aR)-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazole-2-thione |
| SMILES | S=C1O[C@@H]2CCCC[C@@H]2N1c1ccccc1 |
| InChI | InChI=1S/C13H15NOS/c16-13-14(10-6-2-1-3-7-10)11-8-4-5-9-12(11)15-13/h1-3,6-7,11-12H,4-5,8-9H2/t11-,12+/m0/s1 |
| InChIKey | COOALMGTLCBHOA-NWDGAFQWSA-N |
| XLogP | 3.12 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.34 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|