C13H16N2O2 — CID 115038863
5-amino-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one (PubChem CID 115038863) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 5-amino-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one.
| Compound Name | 5-amino-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
|---|---|
| PubChem CID | 115038863 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 5-amino-3-phenyl-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-2-one |
| SMILES | NC1CCC2OC(=O)N(c3ccccc3)C2C1 |
| InChI | InChI=1S/C13H16N2O2/c14-9-6-7-12-11(8-9)15(13(16)17-12)10-4-2-1-3-5-10/h1-5,9,11-12H,6-8,14H2 |
| InChIKey | FDLIKIRNPMEZCN-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |