C23H20N2O4 — CID 101229388
(1S,7S,8R,12S)-5,10-diphenyl-3-oxa-5,10-diazatetracyclo[5.5.2.02,6.08,12]tetradecane-4,9,11-trione (PubChem CID 101229388) has the molecular formula C23H20N2O4 and a molecular weight of 388.42 g/mol. Its IUPAC name is (1S,7S,8R,12S)-5,10-diphenyl-3-oxa-5,10-diazatetracyclo[5.5.2.02,6.08,12]tetradecane-4,9,11-trione.
| Compound Name | (1S,7S,8R,12S)-5,10-diphenyl-3-oxa-5,10-diazatetracyclo[5.5.2.02,6.08,12]tetradecane-4,9,11-trione |
|---|---|
| PubChem CID | 101229388 |
| Molecular Formula | C23H20N2O4 |
| Molecular Weight | 388.42 g/mol |
| Exact Mass | 388.14 |
| IUPAC Name | (1S,7S,8R,12S)-5,10-diphenyl-3-oxa-5,10-diazatetracyclo[5.5.2.02,6.08,12]tetradecane-4,9,11-trione |
| SMILES | O=C1[C@@H]2[C@H](C(=O)N1c1ccccc1)[C@@H]1CC[C@@H]2C2OC(=O)N(c3ccccc3)C21 |
| InChI | InChI=1S/C23H20N2O4/c26-21-17-15-11-12-16(18(17)22(27)25(21)14-9-5-2-6-10-14)20-19(15)24(23(28)29-20)13-7-3-1-4-8-13/h1-10,15-20H,11-12H2/t15-,16-,17+,18-,19?,20?/m0/s1 |
| InChIKey | RRNPOEIQSDAPMJ-MFVOSEHLSA-N |
| XLogP | 3.23 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.42 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|