C9H7NO3 — CID 101253932
4-phenyl-2,6-dioxa-4-azabicyclo[3.1.0]hexan-3-one (PubChem CID 101253932) has the molecular formula C9H7NO3 and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-phenyl-2,6-dioxa-4-azabicyclo[3.1.0]hexan-3-one.
| Compound Name | 4-phenyl-2,6-dioxa-4-azabicyclo[3.1.0]hexan-3-one |
|---|---|
| PubChem CID | 101253932 |
| Molecular Formula | C9H7NO3 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 4-phenyl-2,6-dioxa-4-azabicyclo[3.1.0]hexan-3-one |
| SMILES | O=C1OC2OC2N1c1ccccc1 |
| InChI | InChI=1S/C9H7NO3/c11-9-10(7-8(12-7)13-9)6-4-2-1-3-5-6/h1-5,7-8H |
| InChIKey | IYTZMTGEICEEDC-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 42.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|