C18H18N2O3 — CID 561921
2,4-diphenyl-5-propan-2-yl-1,2,4-oxadiazinane-3,6-dione (PubChem CID 561921) has the molecular formula C18H18N2O3 and a molecular weight of 310.35 g/mol. Its IUPAC name is 2,4-diphenyl-5-propan-2-yl-1,2,4-oxadiazinane-3,6-dione.
| Compound Name | 2,4-diphenyl-5-propan-2-yl-1,2,4-oxadiazinane-3,6-dione |
|---|---|
| PubChem CID | 561921 |
| Molecular Formula | C18H18N2O3 |
| Molecular Weight | 310.35 g/mol |
| Exact Mass | 310.13 |
| IUPAC Name | 2,4-diphenyl-5-propan-2-yl-1,2,4-oxadiazinane-3,6-dione |
| SMILES | CC(C)C1C(=O)ON(c2ccccc2)C(=O)N1c1ccccc1 |
| InChI | InChI=1S/C18H18N2O3/c1-13(2)16-17(21)23-20(15-11-7-4-8-12-15)18(22)19(16)14-9-5-3-6-10-14/h3-13,16H,1-2H3 |
| InChIKey | YVXRWRQHZJIRJJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |