C22H24N2S — CID 102358261
(5S,9S)-6,8-diphenyl-6,8-diazatricyclo[7.3.0.01,5]dodecane-7-thione (PubChem CID 102358261) has the molecular formula C22H24N2S and a molecular weight of 348.51 g/mol. Its IUPAC name is (5S,9S)-6,8-diphenyl-6,8-diazatricyclo[7.3.0.01,5]dodecane-7-thione.
| Compound Name | (5S,9S)-6,8-diphenyl-6,8-diazatricyclo[7.3.0.01,5]dodecane-7-thione |
|---|---|
| PubChem CID | 102358261 |
| Molecular Formula | C22H24N2S |
| Molecular Weight | 348.51 g/mol |
| Exact Mass | 348.17 |
| IUPAC Name | (5S,9S)-6,8-diphenyl-6,8-diazatricyclo[7.3.0.01,5]dodecane-7-thione |
| SMILES | S=C1N(c2ccccc2)[C@H]2CCCC23CCC[C@@H]3N1c1ccccc1 |
| InChI | InChI=1S/C22H24N2S/c25-21-23(17-9-3-1-4-10-17)19-13-7-15-22(19)16-8-14-20(22)24(21)18-11-5-2-6-12-18/h1-6,9-12,19-20H,7-8,13-16H2/t19-,20-,22?/m0/s1 |
| InChIKey | XADROXOIYCZCGE-ZDOMSUIMSA-N |
| XLogP | 5.39 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.51 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|