C30H24N4PtS6 — CID 140616791
bis(1,3-diphenyl-2-sulfanylideneimidazolidine-4,5-dithiolate);platinum(4+) (PubChem CID 140616791) has the molecular formula C30H24N4PtS6 and a molecular weight of 828.03 g/mol. Its IUPAC name is bis(1,3-diphenyl-2-sulfanylideneimidazolidine-4,5-dithiolate);platinum(4+).
| Compound Name | bis(1,3-diphenyl-2-sulfanylideneimidazolidine-4,5-dithiolate);platinum(4+) |
|---|---|
| PubChem CID | 140616791 |
| Molecular Formula | C30H24N4PtS6 |
| Molecular Weight | 828.03 g/mol |
| Exact Mass | 827.00 |
| IUPAC Name | bis(1,3-diphenyl-2-sulfanylideneimidazolidine-4,5-dithiolate);platinum(4+) |
| SMILES | S=C1N(c2ccccc2)C([S-])C([S-])N1c1ccccc1.S=C1N(c2ccccc2)C([S-])C([S-])N1c1ccccc1.[Pt+4] |
| InChI | InChI=1S/2C15H14N2S3.Pt/c2*18-13-14(19)17(12-9-5-2-6-10-12)15(20)16(13)11-7-3-1-4-8-11;/h2*1-10,13-14,18-19H;/q;;+4/p-4 |
| InChIKey | FWNYCRPMSZCNKG-UHFFFAOYSA-J |
| XLogP | 6.09 |
| TPSA | 12.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 828.03 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|