C19H21NO — CID 13085430
7,8-diphenyl-7-azabicyclo[4.2.0]octan-1-ol (PubChem CID 13085430) has the molecular formula C19H21NO and a molecular weight of 279.38 g/mol. Its IUPAC name is 7,8-diphenyl-7-azabicyclo[4.2.0]octan-1-ol.
| Compound Name | 7,8-diphenyl-7-azabicyclo[4.2.0]octan-1-ol |
|---|---|
| PubChem CID | 13085430 |
| Molecular Formula | C19H21NO |
| Molecular Weight | 279.38 g/mol |
| Exact Mass | 279.16 |
| IUPAC Name | 7,8-diphenyl-7-azabicyclo[4.2.0]octan-1-ol |
| SMILES | OC12CCCCC1N(c1ccccc1)C2c1ccccc1 |
| InChI | InChI=1S/C19H21NO/c21-19-14-8-7-13-17(19)20(16-11-5-2-6-12-16)18(19)15-9-3-1-4-10-15/h1-6,9-12,17-18,21H,7-8,13-14H2 |
| InChIKey | YPPPUPDOFDVPMG-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.38 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |