C16H21NO2 — CID 11889561
(2R,4aR,8aS)-4a-hydroxy-1-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-4-one (PubChem CID 11889561) has the molecular formula C16H21NO2 and a molecular weight of 259.35 g/mol. Its IUPAC name is (2R,4aR,8aS)-4a-hydroxy-1-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-4-one.
| Compound Name | (2R,4aR,8aS)-4a-hydroxy-1-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-4-one |
|---|---|
| PubChem CID | 11889561 |
| Molecular Formula | C16H21NO2 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.16 |
| IUPAC Name | (2R,4aR,8aS)-4a-hydroxy-1-methyl-2-phenyl-3,5,6,7,8,8a-hexahydro-2H-quinolin-4-one |
| SMILES | CN1[C@@H](c2ccccc2)CC(=O)[C@@]2(O)CCCC[C@H]12 |
| InChI | InChI=1S/C16H21NO2/c1-17-13(12-7-3-2-4-8-12)11-15(18)16(19)10-6-5-9-14(16)17/h2-4,7-8,13-14,19H,5-6,9-11H2,1H3/t13-,14+,16-/m1/s1 |
| InChIKey | HKCYHEPGBFQGFR-IJEWVQPXSA-N |
| XLogP | 2.31 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |