C13H11F2NO2 — CID 132839246
2-(2,2-difluorocyclopentyl)isoindole-1,3-dione (PubChem CID 132839246) has the molecular formula C13H11F2NO2 and a molecular weight of 251.23 g/mol. Its IUPAC name is 2-(2,2-difluorocyclopentyl)isoindole-1,3-dione.
| Compound Name | 2-(2,2-difluorocyclopentyl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 132839246 |
| Molecular Formula | C13H11F2NO2 |
| Molecular Weight | 251.23 g/mol |
| Exact Mass | 251.08 |
| IUPAC Name | 2-(2,2-difluorocyclopentyl)isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1C1CCCC1(F)F |
| InChI | InChI=1S/C13H11F2NO2/c14-13(15)7-3-6-10(13)16-11(17)8-4-1-2-5-9(8)12(16)18/h1-2,4-5,10H,3,6-7H2 |
| InChIKey | PXUNSPJHDSGOJJ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|