C15H26O3 — CID 102155837
(5E)-8,8-bis(methoxymethyl)undeca-5,10-dien-2-one (PubChem CID 102155837) has the molecular formula C15H26O3 and a molecular weight of 254.37 g/mol. Its IUPAC name is (5E)-8,8-bis(methoxymethyl)undeca-5,10-dien-2-one.
| Compound Name | (5E)-8,8-bis(methoxymethyl)undeca-5,10-dien-2-one |
|---|---|
| PubChem CID | 102155837 |
| Molecular Formula | C15H26O3 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.19 |
| IUPAC Name | (5E)-8,8-bis(methoxymethyl)undeca-5,10-dien-2-one |
| SMILES | C=CCC(C/C=C/CCC(C)=O)(COC)COC |
| InChI | InChI=1S/C15H26O3/c1-5-10-15(12-17-3,13-18-4)11-8-6-7-9-14(2)16/h5-6,8H,1,7,9-13H2,2-4H3/b8-6+ |
| InChIKey | IFVCPZRCAKQDBN-SOFGYWHQSA-N |
| XLogP | 3.16 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|