C19H23ClN4O6 — CID 102157682
[(2S)-1-(4-tert-butylphenoxy)-3-(2-nitroimidazol-1-yl)propan-2-yl] N-(2-chloroacetyl)carbamate (PubChem CID 102157682) has the molecular formula C19H23ClN4O6 and a molecular weight of 438.87 g/mol. Its IUPAC name is [(2S)-1-(4-tert-butylphenoxy)-3-(2-nitroimidazol-1-yl)propan-2-yl] N-(2-chloroacetyl)carbamate.
| Compound Name | [(2S)-1-(4-tert-butylphenoxy)-3-(2-nitroimidazol-1-yl)propan-2-yl] N-(2-chloroacetyl)carbamate |
|---|---|
| PubChem CID | 102157682 |
| Molecular Formula | C19H23ClN4O6 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.13 |
| IUPAC Name | [(2S)-1-(4-tert-butylphenoxy)-3-(2-nitroimidazol-1-yl)propan-2-yl] N-(2-chloroacetyl)carbamate |
| SMILES | CC(C)(C)c1ccc(OC[C@H](Cn2ccnc2[N+](=O)[O-])OC(=O)NC(=O)CCl)cc1 |
| InChI | InChI=1S/C19H23ClN4O6/c1-19(2,3)13-4-6-14(7-5-13)29-12-15(30-18(26)22-16(25)10-20)11-23-9-8-21-17(23)24(27)28/h4-9,15H,10-12H2,1-3H3,(H,22,25,26)/t15-/m0/s1 |
| InChIKey | LJZWMKUYLIKUPD-HNNXBMFYSA-N |
| XLogP | 3.03 |
| TPSA | 125.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|