C15H18O3 — CID 102157745
propan-2-yl (2S,3R)-3-[(E)-1-phenylprop-1-en-2-yl]oxirane-2-carboxylate (PubChem CID 102157745) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is propan-2-yl (2S,3R)-3-[(E)-1-phenylprop-1-en-2-yl]oxirane-2-carboxylate.
| Compound Name | propan-2-yl (2S,3R)-3-[(E)-1-phenylprop-1-en-2-yl]oxirane-2-carboxylate |
|---|---|
| PubChem CID | 102157745 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | propan-2-yl (2S,3R)-3-[(E)-1-phenylprop-1-en-2-yl]oxirane-2-carboxylate |
| SMILES | C/C(=C\c1ccccc1)[C@H]1O[C@@H]1C(=O)OC(C)C |
| InChI | InChI=1S/C15H18O3/c1-10(2)17-15(16)14-13(18-14)11(3)9-12-7-5-4-6-8-12/h4-10,13-14H,1-3H3/b11-9+/t13-,14+/m1/s1 |
| InChIKey | XDGDXIUFCRASLR-CACDNMLQSA-N |
| XLogP | 2.81 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|