C14H24O3 — CID 102158596
(1S,3aR,7S,8aS)-1-hydroxy-7-(2-hydroxypropan-2-yl)-1-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one (PubChem CID 102158596) has the molecular formula C14H24O3 and a molecular weight of 240.34 g/mol. Its IUPAC name is (1S,3aR,7S,8aS)-1-hydroxy-7-(2-hydroxypropan-2-yl)-1-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one.
| Compound Name | (1S,3aR,7S,8aS)-1-hydroxy-7-(2-hydroxypropan-2-yl)-1-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one |
|---|---|
| PubChem CID | 102158596 |
| Molecular Formula | C14H24O3 |
| Molecular Weight | 240.34 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | (1S,3aR,7S,8aS)-1-hydroxy-7-(2-hydroxypropan-2-yl)-1-methyl-2,3,3a,5,6,7,8,8a-octahydroazulen-4-one |
| SMILES | CC(C)(O)[C@H]1CCC(=O)[C@@H]2CC[C@](C)(O)[C@H]2C1 |
| InChI | InChI=1S/C14H24O3/c1-13(2,16)9-4-5-12(15)10-6-7-14(3,17)11(10)8-9/h9-11,16-17H,4-8H2,1-3H3/t9-,10+,11-,14-/m0/s1 |
| InChIKey | CBAIWCFSNJGPTD-MIJXAVMKSA-N |
| XLogP | 1.90 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.34 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |