C14H18O — CID 102158712
(3S)-4-ethyl-1-phenylhexa-4,5-dien-3-ol (PubChem CID 102158712) has the molecular formula C14H18O and a molecular weight of 202.30 g/mol. Its IUPAC name is (3S)-4-ethyl-1-phenylhexa-4,5-dien-3-ol.
| Compound Name | (3S)-4-ethyl-1-phenylhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 102158712 |
| Molecular Formula | C14H18O |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.14 |
| IUPAC Name | (3S)-4-ethyl-1-phenylhexa-4,5-dien-3-ol |
| SMILES | C=C=C(CC)[C@@H](O)CCc1ccccc1 |
| InChI | InChI=1S/C14H18O/c1-3-13(4-2)14(15)11-10-12-8-6-5-7-9-12/h5-9,14-15H,1,4,10-11H2,2H3/t14-/m0/s1 |
| InChIKey | UKKSDCHOWRFJJJ-AWEZNQCLSA-N |
| XLogP | 3.10 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |