C15H22OSi — CID 12670486
1-phenyl-4-trimethylsilylhexa-4,5-dien-3-ol (PubChem CID 12670486) has the molecular formula C15H22OSi and a molecular weight of 246.43 g/mol. Its IUPAC name is 1-phenyl-4-trimethylsilylhexa-4,5-dien-3-ol.
| Compound Name | 1-phenyl-4-trimethylsilylhexa-4,5-dien-3-ol |
|---|---|
| PubChem CID | 12670486 |
| Molecular Formula | C15H22OSi |
| Molecular Weight | 246.43 g/mol |
| Exact Mass | 246.14 |
| IUPAC Name | 1-phenyl-4-trimethylsilylhexa-4,5-dien-3-ol |
| SMILES | C=C=C(C(O)CCc1ccccc1)[Si](C)(C)C |
| InChI | InChI=1S/C15H22OSi/c1-5-15(17(2,3)4)14(16)12-11-13-9-7-6-8-10-13/h6-10,14,16H,1,11-12H2,2-4H3 |
| InChIKey | HCRVXFRXKQJSRI-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.43 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|