C11H20O — CID 86016621
3-ethylnona-1,2-dien-4-ol (PubChem CID 86016621) has the molecular formula C11H20O and a molecular weight of 168.28 g/mol. Its IUPAC name is 3-ethylnona-1,2-dien-4-ol.
| Compound Name | 3-ethylnona-1,2-dien-4-ol |
|---|---|
| PubChem CID | 86016621 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 3-ethylnona-1,2-dien-4-ol |
| SMILES | C=C=C(CC)C(O)CCCCC |
| InChI | InChI=1S/C11H20O/c1-4-7-8-9-11(12)10(5-2)6-3/h11-12H,2,4,6-9H2,1,3H3 |
| InChIKey | YSRHWXJYRBMUOU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|