C8H13Br3O — CID 10785026
1,1,2-tribromooct-1-en-3-ol (PubChem CID 10785026) has the molecular formula C8H13Br3O and a molecular weight of 364.90 g/mol. Its IUPAC name is 1,1,2-tribromooct-1-en-3-ol.
| Compound Name | 1,1,2-tribromooct-1-en-3-ol |
|---|---|
| PubChem CID | 10785026 |
| Molecular Formula | C8H13Br3O |
| Molecular Weight | 364.90 g/mol |
| Exact Mass | 361.85 |
| IUPAC Name | 1,1,2-tribromooct-1-en-3-ol |
| SMILES | CCCCCC(O)C(Br)=C(Br)Br |
| InChI | InChI=1S/C8H13Br3O/c1-2-3-4-5-6(12)7(9)8(10)11/h6,12H,2-5H2,1H3 |
| InChIKey | OMXFNJKEFPNNIB-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.90 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|