C24H34O4Si — CID 102158896
methyl 3-[4-[diethyl(4-phenylbutyl)silyl]oxyphenoxy]propanoate (PubChem CID 102158896) has the molecular formula C24H34O4Si and a molecular weight of 414.62 g/mol. Its IUPAC name is methyl 3-[4-[diethyl(4-phenylbutyl)silyl]oxyphenoxy]propanoate.
| Compound Name | methyl 3-[4-[diethyl(4-phenylbutyl)silyl]oxyphenoxy]propanoate |
|---|---|
| PubChem CID | 102158896 |
| Molecular Formula | C24H34O4Si |
| Molecular Weight | 414.62 g/mol |
| Exact Mass | 414.22 |
| IUPAC Name | methyl 3-[4-[diethyl(4-phenylbutyl)silyl]oxyphenoxy]propanoate |
| SMILES | CC[Si](CC)(CCCCc1ccccc1)Oc1ccc(OCCC(=O)OC)cc1 |
| InChI | InChI=1S/C24H34O4Si/c1-4-29(5-2,20-10-9-13-21-11-7-6-8-12-21)28-23-16-14-22(15-17-23)27-19-18-24(25)26-3/h6-8,11-12,14-17H,4-5,9-10,13,18-20H2,1-3H3 |
| InChIKey | LUQFBAMONMEHIS-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.62 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|