C28H34N2O4S2 — CID 102159177
4-methyl-N-[(1R,6S)-6-[2-methylidenebut-3-enyl-(4-methylphenyl)sulfonylamino]cyclohex-3-en-1-yl]-N-prop-2-enylbenzenesulfonamide (PubChem CID 102159177) has the molecular formula C28H34N2O4S2 and a molecular weight of 526.72 g/mol. Its IUPAC name is 4-methyl-N-[(1R,6S)-6-[2-methylidenebut-3-enyl-(4-methylphenyl)sulfonylamino]cyclohex-3-en-1-yl]-N-prop-2-enylbenzenesulfonamide.
| Compound Name | 4-methyl-N-[(1R,6S)-6-[2-methylidenebut-3-enyl-(4-methylphenyl)sulfonylamino]cyclohex-3-en-1-yl]-N-prop-2-enylbenzenesulfonamide |
|---|---|
| PubChem CID | 102159177 |
| Molecular Formula | C28H34N2O4S2 |
| Molecular Weight | 526.72 g/mol |
| Exact Mass | 526.20 |
| IUPAC Name | 4-methyl-N-[(1R,6S)-6-[2-methylidenebut-3-enyl-(4-methylphenyl)sulfonylamino]cyclohex-3-en-1-yl]-N-prop-2-enylbenzenesulfonamide |
| SMILES | C=CCN([C@@H]1CC=CC[C@@H]1N(CC(=C)C=C)S(=O)(=O)c1ccc(C)cc1)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H34N2O4S2/c1-6-20-29(35(31,32)25-16-12-23(4)13-17-25)27-10-8-9-11-28(27)30(21-22(3)7-2)36(33,34)26-18-14-24(5)15-19-26/h6-9,12-19,27-28H,1-3,10-11,20-21H2,4-5H3/t27-,28+/m1/s1 |
| InChIKey | COEHMYZUDNVAPT-IZLXSDGUSA-N |
| XLogP | 5.00 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.72 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|