C19H24Br2N2O3S — CID 102160114
[3,5-bis(bromomethyl)phenyl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate (PubChem CID 102160114) has the molecular formula C19H24Br2N2O3S and a molecular weight of 520.29 g/mol. Its IUPAC name is [3,5-bis(bromomethyl)phenyl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate.
| Compound Name | [3,5-bis(bromomethyl)phenyl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
|---|---|
| PubChem CID | 102160114 |
| Molecular Formula | C19H24Br2N2O3S |
| Molecular Weight | 520.29 g/mol |
| Exact Mass | 517.99 |
| IUPAC Name | [3,5-bis(bromomethyl)phenyl]methyl 5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoate |
| SMILES | O=C1N[C@H]2[C@H](CS[C@H]2CCCCC(=O)OCc2cc(CBr)cc(CBr)c2)N1 |
| InChI | InChI=1S/C19H24Br2N2O3S/c20-8-12-5-13(9-21)7-14(6-12)10-26-17(24)4-2-1-3-16-18-15(11-27-16)22-19(25)23-18/h5-7,15-16,18H,1-4,8-11H2,(H2,22,23,25)/t15-,16-,18-/m0/s1 |
| InChIKey | YZOAWQKZUCNHSB-BQFCYCMXSA-N |
| XLogP | 4.25 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.29 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'} |
|---|