C14H16O2 — CID 102162426
4-[2-(5-methylfuran-2-yl)ethyl]hepta-1,6-diyn-4-ol (PubChem CID 102162426) has the molecular formula C14H16O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 4-[2-(5-methylfuran-2-yl)ethyl]hepta-1,6-diyn-4-ol.
| Compound Name | 4-[2-(5-methylfuran-2-yl)ethyl]hepta-1,6-diyn-4-ol |
|---|---|
| PubChem CID | 102162426 |
| Molecular Formula | C14H16O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.12 |
| IUPAC Name | 4-[2-(5-methylfuran-2-yl)ethyl]hepta-1,6-diyn-4-ol |
| SMILES | C#CCC(O)(CC#C)CCc1ccc(C)o1 |
| InChI | InChI=1S/C14H16O2/c1-4-9-14(15,10-5-2)11-8-13-7-6-12(3)16-13/h1-2,6-7,15H,8-11H2,3H3 |
| InChIKey | YDSJTQLOUKQUSA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|