C10H12O2 — CID 124706670
(3R)-5-(5-methylfuran-2-yl)pent-1-yn-3-ol (PubChem CID 124706670) has the molecular formula C10H12O2 and a molecular weight of 164.20 g/mol. Its IUPAC name is (3R)-5-(5-methylfuran-2-yl)pent-1-yn-3-ol.
| Compound Name | (3R)-5-(5-methylfuran-2-yl)pent-1-yn-3-ol |
|---|---|
| PubChem CID | 124706670 |
| Molecular Formula | C10H12O2 |
| Molecular Weight | 164.20 g/mol |
| Exact Mass | 164.08 |
| IUPAC Name | (3R)-5-(5-methylfuran-2-yl)pent-1-yn-3-ol |
| SMILES | C#C[C@H](O)CCc1ccc(C)o1 |
| InChI | InChI=1S/C10H12O2/c1-3-9(11)5-7-10-6-4-8(2)12-10/h1,4,6,9,11H,5,7H2,2H3/t9-/m0/s1 |
| InChIKey | XZGNXKBQOOVNGH-VIFPVBQESA-N |
| XLogP | 1.51 |
| TPSA | 33.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.20 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|