C42H44O7 — CID 102163629
(2S,4R,6R,7R)-7-hydroxy-1,7-bis(3-methoxyphenyl)-2,4,6-tris(phenylmethoxy)heptan-1-one (PubChem CID 102163629) has the molecular formula C42H44O7 and a molecular weight of 660.81 g/mol. Its IUPAC name is (2S,4R,6R,7R)-7-hydroxy-1,7-bis(3-methoxyphenyl)-2,4,6-tris(phenylmethoxy)heptan-1-one.
| Compound Name | (2S,4R,6R,7R)-7-hydroxy-1,7-bis(3-methoxyphenyl)-2,4,6-tris(phenylmethoxy)heptan-1-one |
|---|---|
| PubChem CID | 102163629 |
| Molecular Formula | C42H44O7 |
| Molecular Weight | 660.81 g/mol |
| Exact Mass | 660.31 |
| IUPAC Name | (2S,4R,6R,7R)-7-hydroxy-1,7-bis(3-methoxyphenyl)-2,4,6-tris(phenylmethoxy)heptan-1-one |
| SMILES | COc1cccc(C(=O)[C@H](C[C@@H](C[C@@H](OCc2ccccc2)[C@H](O)c2cccc(OC)c2)OCc2ccccc2)OCc2ccccc2)c1 |
| InChI | InChI=1S/C42H44O7/c1-45-36-22-12-20-34(24-36)41(43)39(48-29-32-16-8-4-9-17-32)26-38(47-28-31-14-6-3-7-15-31)27-40(49-30-33-18-10-5-11-19-33)42(44)35-21-13-23-37(25-35)46-2/h3-25,38-41,43H,26-30H2,1-2H3/t38-,39-,40+,41-/m1/s1 |
| InChIKey | ASFXBFRMRBOSDI-PRURZLHWSA-N |
| XLogP | 8.16 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 660.81 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |