C25H27N5O6 — CID 102165395
benzyl N-[(2S,3R)-2,3-bis(4-nitroanilino)pentyl]carbamate (PubChem CID 102165395) has the molecular formula C25H27N5O6 and a molecular weight of 493.52 g/mol. Its IUPAC name is benzyl N-[(2S,3R)-2,3-bis(4-nitroanilino)pentyl]carbamate.
| Compound Name | benzyl N-[(2S,3R)-2,3-bis(4-nitroanilino)pentyl]carbamate |
|---|---|
| PubChem CID | 102165395 |
| Molecular Formula | C25H27N5O6 |
| Molecular Weight | 493.52 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | benzyl N-[(2S,3R)-2,3-bis(4-nitroanilino)pentyl]carbamate |
| SMILES | CC[C@@H](Nc1ccc([N+](=O)[O-])cc1)[C@H](CNC(=O)OCc1ccccc1)Nc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C25H27N5O6/c1-2-23(27-19-8-12-21(13-9-19)29(32)33)24(28-20-10-14-22(15-11-20)30(34)35)16-26-25(31)36-17-18-6-4-3-5-7-18/h3-15,23-24,27-28H,2,16-17H2,1H3,(H,26,31)/t23-,24+/m1/s1 |
| InChIKey | UZJDLKCNAALDBT-RPWUZVMVSA-N |
| XLogP | 5.10 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.52 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|