C26H31N5O3 — CID 102166786
(7S,9aR)-7-methyl-2-[2-oxo-1-phenyl-2-(4-phenylpiperazin-1-yl)ethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione (PubChem CID 102166786) has the molecular formula C26H31N5O3 and a molecular weight of 461.57 g/mol. Its IUPAC name is (7S,9aR)-7-methyl-2-[2-oxo-1-phenyl-2-(4-phenylpiperazin-1-yl)ethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione.
| Compound Name | (7S,9aR)-7-methyl-2-[2-oxo-1-phenyl-2-(4-phenylpiperazin-1-yl)ethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
|---|---|
| PubChem CID | 102166786 |
| Molecular Formula | C26H31N5O3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.24 |
| IUPAC Name | (7S,9aR)-7-methyl-2-[2-oxo-1-phenyl-2-(4-phenylpiperazin-1-yl)ethyl]-1,3,4,7,8,9a-hexahydropyrazino[1,2-a]pyrazine-6,9-dione |
| SMILES | C[C@@H]1NC(=O)[C@H]2CN(C(C(=O)N3CCN(c4ccccc4)CC3)c3ccccc3)CCN2C1=O |
| InChI | InChI=1S/C26H31N5O3/c1-19-25(33)31-17-16-30(18-22(31)24(32)27-19)23(20-8-4-2-5-9-20)26(34)29-14-12-28(13-15-29)21-10-6-3-7-11-21/h2-11,19,22-23H,12-18H2,1H3,(H,27,32)/t19-,22+,23?/m0/s1 |
| InChIKey | WFDKHFDTCYXABW-BEUBQONESA-N |
| XLogP | 1.11 |
| TPSA | 76.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |