C11H11N3O2 — CID 102169202
6-(cyanomethylamino)-2,3-dimethoxybenzonitrile (PubChem CID 102169202) has the molecular formula C11H11N3O2 and a molecular weight of 217.23 g/mol. Its IUPAC name is 6-(cyanomethylamino)-2,3-dimethoxybenzonitrile.
| Compound Name | 6-(cyanomethylamino)-2,3-dimethoxybenzonitrile |
|---|---|
| PubChem CID | 102169202 |
| Molecular Formula | C11H11N3O2 |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.09 |
| IUPAC Name | 6-(cyanomethylamino)-2,3-dimethoxybenzonitrile |
| SMILES | COc1ccc(NCC#N)c(C#N)c1OC |
| InChI | InChI=1S/C11H11N3O2/c1-15-10-4-3-9(14-6-5-12)8(7-13)11(10)16-2/h3-4,14H,6H2,1-2H3 |
| InChIKey | HNDUAIBDOJSULN-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 78.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|