C26H24O3 — CID 102174292
5-(4-methoxyphenyl)-3-[methoxy(phenyl)methyl]-5-phenylpenta-3,4-dien-2-one (PubChem CID 102174292) has the molecular formula C26H24O3 and a molecular weight of 384.48 g/mol. Its IUPAC name is 5-(4-methoxyphenyl)-3-[methoxy(phenyl)methyl]-5-phenylpenta-3,4-dien-2-one.
| Compound Name | 5-(4-methoxyphenyl)-3-[methoxy(phenyl)methyl]-5-phenylpenta-3,4-dien-2-one |
|---|---|
| PubChem CID | 102174292 |
| Molecular Formula | C26H24O3 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | 5-(4-methoxyphenyl)-3-[methoxy(phenyl)methyl]-5-phenylpenta-3,4-dien-2-one |
| SMILES | COc1ccc(C(=C=C(C(C)=O)C(OC)c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H24O3/c1-19(27)24(26(29-3)22-12-8-5-9-13-22)18-25(20-10-6-4-7-11-20)21-14-16-23(28-2)17-15-21/h4-17,26H,1-3H3 |
| InChIKey | TWHZVPISXZTNPX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|