C25H25N — CID 102174726
(2S,5R)-2-[(1S)-2,3-dihydro-1H-inden-1-yl]-1,5-diphenylpyrrolidine (PubChem CID 102174726) has the molecular formula C25H25N and a molecular weight of 339.48 g/mol. Its IUPAC name is (2S,5R)-2-[(1S)-2,3-dihydro-1H-inden-1-yl]-1,5-diphenylpyrrolidine.
| Compound Name | (2S,5R)-2-[(1S)-2,3-dihydro-1H-inden-1-yl]-1,5-diphenylpyrrolidine |
|---|---|
| PubChem CID | 102174726 |
| Molecular Formula | C25H25N |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.20 |
| IUPAC Name | (2S,5R)-2-[(1S)-2,3-dihydro-1H-inden-1-yl]-1,5-diphenylpyrrolidine |
| SMILES | c1ccc([C@H]2CC[C@@H]([C@H]3CCc4ccccc43)N2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N/c1-3-10-20(11-4-1)24-17-18-25(26(24)21-12-5-2-6-13-21)23-16-15-19-9-7-8-14-22(19)23/h1-14,23-25H,15-18H2/t23-,24+,25-/m0/s1 |
| InChIKey | IFWYYYBPULXFRH-GVAUOCQISA-N |
| XLogP | 6.13 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |