C17H14N2O — CID 102177678
(7Z)-7-benzylidene-6-prop-2-enylpyrrolo[3,4-b]pyridin-5-one (PubChem CID 102177678) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is (7Z)-7-benzylidene-6-prop-2-enylpyrrolo[3,4-b]pyridin-5-one.
| Compound Name | (7Z)-7-benzylidene-6-prop-2-enylpyrrolo[3,4-b]pyridin-5-one |
|---|---|
| PubChem CID | 102177678 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (7Z)-7-benzylidene-6-prop-2-enylpyrrolo[3,4-b]pyridin-5-one |
| SMILES | C=CCN1C(=O)c2cccnc2/C1=C/c1ccccc1 |
| InChI | InChI=1S/C17H14N2O/c1-2-11-19-15(12-13-7-4-3-5-8-13)16-14(17(19)20)9-6-10-18-16/h2-10,12H,1,11H2/b15-12- |
| InChIKey | IUFVTUDPYKAXCP-QINSGFPZSA-N |
| XLogP | 3.22 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|