C23H31N2OP — CID 102179122
2-benzhydryloxy-1,3-ditert-butyl-1,3,2-diazaphosphole (PubChem CID 102179122) has the molecular formula C23H31N2OP and a molecular weight of 382.49 g/mol. Its IUPAC name is 2-benzhydryloxy-1,3-ditert-butyl-1,3,2-diazaphosphole.
| Compound Name | 2-benzhydryloxy-1,3-ditert-butyl-1,3,2-diazaphosphole |
|---|---|
| PubChem CID | 102179122 |
| Molecular Formula | C23H31N2OP |
| Molecular Weight | 382.49 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | 2-benzhydryloxy-1,3-ditert-butyl-1,3,2-diazaphosphole |
| SMILES | CC(C)(C)N1C=CN(C(C)(C)C)P1OC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C23H31N2OP/c1-22(2,3)24-17-18-25(23(4,5)6)27(24)26-21(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h7-18,21H,1-6H3 |
| InChIKey | NJNHLBHMJWZVNO-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.49 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|