C18H30O6 — CID 102179842
methyl (E,4R,5R,6R,7S)-5,7-diacetyloxy-2,4,6,8-tetramethylnon-2-enoate (PubChem CID 102179842) has the molecular formula C18H30O6 and a molecular weight of 342.43 g/mol. Its IUPAC name is methyl (E,4R,5R,6R,7S)-5,7-diacetyloxy-2,4,6,8-tetramethylnon-2-enoate.
| Compound Name | methyl (E,4R,5R,6R,7S)-5,7-diacetyloxy-2,4,6,8-tetramethylnon-2-enoate |
|---|---|
| PubChem CID | 102179842 |
| Molecular Formula | C18H30O6 |
| Molecular Weight | 342.43 g/mol |
| Exact Mass | 342.20 |
| IUPAC Name | methyl (E,4R,5R,6R,7S)-5,7-diacetyloxy-2,4,6,8-tetramethylnon-2-enoate |
| SMILES | COC(=O)/C(C)=C/[C@@H](C)[C@@H](OC(C)=O)[C@H](C)[C@@H](OC(C)=O)C(C)C |
| InChI | InChI=1S/C18H30O6/c1-10(2)16(23-14(6)19)13(5)17(24-15(7)20)11(3)9-12(4)18(21)22-8/h9-11,13,16-17H,1-8H3/b12-9+/t11-,13-,16+,17-/m1/s1 |
| InChIKey | BVKIYQIYUIIDMC-YPWUDFATSA-N |
| XLogP | 2.90 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.43 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|