C24H32O8 — CID 102180271
tetramethyl (1R,3aS,5aR,8aS,8bS)-8-methylidene-1-prop-1-en-2-yl-2,3a,4,5,5a,7,8a,8b-octahydro-1H-as-indacene-3,3,6,6-tetracarboxylate (PubChem CID 102180271) has the molecular formula C24H32O8 and a molecular weight of 448.51 g/mol. Its IUPAC name is tetramethyl (1R,3aS,5aR,8aS,8bS)-8-methylidene-1-prop-1-en-2-yl-2,3a,4,5,5a,7,8a,8b-octahydro-1H-as-indacene-3,3,6,6-tetracarboxylate.
| Compound Name | tetramethyl (1R,3aS,5aR,8aS,8bS)-8-methylidene-1-prop-1-en-2-yl-2,3a,4,5,5a,7,8a,8b-octahydro-1H-as-indacene-3,3,6,6-tetracarboxylate |
|---|---|
| PubChem CID | 102180271 |
| Molecular Formula | C24H32O8 |
| Molecular Weight | 448.51 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | tetramethyl (1R,3aS,5aR,8aS,8bS)-8-methylidene-1-prop-1-en-2-yl-2,3a,4,5,5a,7,8a,8b-octahydro-1H-as-indacene-3,3,6,6-tetracarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)[C@@H]2CC[C@H]3[C@@H]([C@H]12)[C@H](C(=C)C)CC3(C(=O)OC)C(=O)OC |
| InChI | InChI=1S/C24H32O8/c1-12(2)14-11-24(21(27)31-6,22(28)32-7)16-9-8-15-17(18(14)16)13(3)10-23(15,19(25)29-4)20(26)30-5/h14-18H,1,3,8-11H2,2,4-7H3/t14-,15+,16-,17+,18-/m0/s1 |
| InChIKey | TXXGFPKQASVLEY-RZFLPCETSA-N |
| XLogP | 2.47 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|