C16H25FO2 — CID 134853725
methyl (1R)-1-(3-fluoroprop-1-en-2-yl)-6,7-dimethyl-1,2,3,4,5,6,7,7a-octahydroindene-3a-carboxylate (PubChem CID 134853725) has the molecular formula C16H25FO2 and a molecular weight of 268.37 g/mol. Its IUPAC name is methyl (1R)-1-(3-fluoroprop-1-en-2-yl)-6,7-dimethyl-1,2,3,4,5,6,7,7a-octahydroindene-3a-carboxylate.
| Compound Name | methyl (1R)-1-(3-fluoroprop-1-en-2-yl)-6,7-dimethyl-1,2,3,4,5,6,7,7a-octahydroindene-3a-carboxylate |
|---|---|
| PubChem CID | 134853725 |
| Molecular Formula | C16H25FO2 |
| Molecular Weight | 268.37 g/mol |
| Exact Mass | 268.18 |
| IUPAC Name | methyl (1R)-1-(3-fluoroprop-1-en-2-yl)-6,7-dimethyl-1,2,3,4,5,6,7,7a-octahydroindene-3a-carboxylate |
| SMILES | C=C(CF)[C@@H]1CCC2(C(=O)OC)CCC(C)C(C)C12 |
| InChI | InChI=1S/C16H25FO2/c1-10-5-7-16(15(18)19-4)8-6-13(11(2)9-17)14(16)12(10)3/h10,12-14H,2,5-9H2,1,3-4H3/t10?,12?,13-,14?,16?/m0/s1 |
| InChIKey | YHGQDVMERFOYGW-HYKREUMHSA-N |
| XLogP | 3.76 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.37 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|