C17H26F2O2 — CID 134969873
methyl (1R)-1-(3,3-difluoroprop-1-en-2-yl)-6,6,7-trimethyl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate (PubChem CID 134969873) has the molecular formula C17H26F2O2 and a molecular weight of 300.39 g/mol. Its IUPAC name is methyl (1R)-1-(3,3-difluoroprop-1-en-2-yl)-6,6,7-trimethyl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate.
| Compound Name | methyl (1R)-1-(3,3-difluoroprop-1-en-2-yl)-6,6,7-trimethyl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate |
|---|---|
| PubChem CID | 134969873 |
| Molecular Formula | C17H26F2O2 |
| Molecular Weight | 300.39 g/mol |
| Exact Mass | 300.19 |
| IUPAC Name | methyl (1R)-1-(3,3-difluoroprop-1-en-2-yl)-6,6,7-trimethyl-2,3,4,5,7,7a-hexahydro-1H-indene-3a-carboxylate |
| SMILES | C=C(C(F)F)[C@@H]1CCC2(C(=O)OC)CCC(C)(C)C(C)C12 |
| InChI | InChI=1S/C17H26F2O2/c1-10(14(18)19)12-6-7-17(15(20)21-5)9-8-16(3,4)11(2)13(12)17/h11-14H,1,6-9H2,2-5H3/t11?,12-,13?,17?/m0/s1 |
| InChIKey | CZFLZEUKJHGFAD-VUOPQECKSA-N |
| XLogP | 4.45 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.39 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|