C15H10F6O4 — CID 102182617
[(9S,11R)-11-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,2,2-trifluoroacetate (PubChem CID 102182617) has the molecular formula C15H10F6O4 and a molecular weight of 368.23 g/mol. Its IUPAC name is [(9S,11R)-11-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,2,2-trifluoroacetate.
| Compound Name | [(9S,11R)-11-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 102182617 |
| Molecular Formula | C15H10F6O4 |
| Molecular Weight | 368.23 g/mol |
| Exact Mass | 368.05 |
| IUPAC Name | [(9S,11R)-11-(2,2,2-trifluoroacetyl)oxy-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@@H]1C2C[C@H](OC(=O)C(F)(F)F)C1c1ccccc12)C(F)(F)F |
| InChI | InChI=1S/C15H10F6O4/c16-14(17,18)12(22)24-9-5-8-6-3-1-2-4-7(6)10(9)11(8)25-13(23)15(19,20)21/h1-4,8-11H,5H2/t8?,9-,10?,11+/m0/s1 |
| InChIKey | PQEPMCXQAWJOCB-QONHTCSSSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |