C13H12O3 — CID 11413275
[(1R,8R,9R)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2-oxoacetate (PubChem CID 11413275) has the molecular formula C13H12O3 and a molecular weight of 216.24 g/mol. Its IUPAC name is [(1R,8R,9R)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2-oxoacetate.
| Compound Name | [(1R,8R,9R)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2-oxoacetate |
|---|---|
| PubChem CID | 11413275 |
| Molecular Formula | C13H12O3 |
| Molecular Weight | 216.24 g/mol |
| Exact Mass | 216.08 |
| IUPAC Name | [(1R,8R,9R)-9-tricyclo[6.2.1.02,7]undeca-2,4,6-trienyl] 2-oxoacetate |
| SMILES | O=CC(=O)O[C@@H]1C[C@H]2C[C@@H]1c1ccccc12 |
| InChI | InChI=1S/C13H12O3/c14-7-13(15)16-12-6-8-5-11(12)10-4-2-1-3-9(8)10/h1-4,7-8,11-12H,5-6H2/t8-,11-,12-/m1/s1 |
| InChIKey | GTLRKMPWEWRXTK-GGZOMVNGSA-N |
| XLogP | 1.77 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.24 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|