C16H10F6O4 — CID 11552638
[(10R,12R)-12-(2,2,2-trifluoroacetyl)oxy-10-tetracyclo[7.2.1.02,11.03,8]dodeca-3,5,7-trienyl] 2,2,2-trifluoroacetate (PubChem CID 11552638) has the molecular formula C16H10F6O4 and a molecular weight of 380.24 g/mol. Its IUPAC name is [(10R,12R)-12-(2,2,2-trifluoroacetyl)oxy-10-tetracyclo[7.2.1.02,11.03,8]dodeca-3,5,7-trienyl] 2,2,2-trifluoroacetate.
| Compound Name | [(10R,12R)-12-(2,2,2-trifluoroacetyl)oxy-10-tetracyclo[7.2.1.02,11.03,8]dodeca-3,5,7-trienyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 11552638 |
| Molecular Formula | C16H10F6O4 |
| Molecular Weight | 380.24 g/mol |
| Exact Mass | 380.05 |
| IUPAC Name | [(10R,12R)-12-(2,2,2-trifluoroacetyl)oxy-10-tetracyclo[7.2.1.02,11.03,8]dodeca-3,5,7-trienyl] 2,2,2-trifluoroacetate |
| SMILES | O=C(O[C@@H]1C2C3c4ccccc4C1[C@H](OC(=O)C(F)(F)F)C32)C(F)(F)F |
| InChI | InChI=1S/C16H10F6O4/c17-15(18,19)13(23)25-11-8-6-4-2-1-3-5(6)7-9(11)10(7)12(8)26-14(24)16(20,21)22/h1-4,7-12H/t7?,8?,9?,10?,11-,12-/m0/s1 |
| InChIKey | JKICSUIWFXHEAK-HRMDSCKTSA-N |
| XLogP | 3.08 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.24 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |