C13H16O2 — CID 10375644
(1R,8R,9S,11R)-9,11-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 10375644) has the molecular formula C13H16O2 and a molecular weight of 204.27 g/mol. Its IUPAC name is (1R,8R,9S,11R)-9,11-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6-triene.
| Compound Name | (1R,8R,9S,11R)-9,11-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6-triene |
|---|---|
| PubChem CID | 10375644 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | (1R,8R,9S,11R)-9,11-dimethoxytricyclo[6.2.1.02,7]undeca-2,4,6-triene |
| SMILES | CO[C@H]1[C@@H]2c3ccccc3[C@H]1C[C@@H]2OC |
| InChI | InChI=1S/C13H16O2/c1-14-11-7-10-8-5-3-4-6-9(8)12(11)13(10)15-2/h3-6,10-13H,7H2,1-2H3/t10-,11+,12-,13-/m1/s1 |
| InChIKey | LTONKWFUYVBPKP-YVECIDJPSA-N |
| XLogP | 2.30 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |