C10H14O5 — CID 102183141
dimethyl (2S,3R)-2,3,4,7-tetrahydrooxepine-2,3-dicarboxylate (PubChem CID 102183141) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is dimethyl (2S,3R)-2,3,4,7-tetrahydrooxepine-2,3-dicarboxylate.
| Compound Name | dimethyl (2S,3R)-2,3,4,7-tetrahydrooxepine-2,3-dicarboxylate |
|---|---|
| PubChem CID | 102183141 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | dimethyl (2S,3R)-2,3,4,7-tetrahydrooxepine-2,3-dicarboxylate |
| SMILES | COC(=O)[C@H]1OCC=CC[C@H]1C(=O)OC |
| InChI | InChI=1S/C10H14O5/c1-13-9(11)7-5-3-4-6-15-8(7)10(12)14-2/h3-4,7-8H,5-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | DWAORQMGYXECNX-SFYZADRCSA-N |
| XLogP | 0.29 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|