C10H14O6 — CID 22884879
(1R,2R)-1-[carboxy(methoxy)methyl]-2-methoxycyclopent-3-ene-1-carboxylic acid (PubChem CID 22884879) has the molecular formula C10H14O6 and a molecular weight of 230.22 g/mol. Its IUPAC name is (1R,2R)-1-[carboxy(methoxy)methyl]-2-methoxycyclopent-3-ene-1-carboxylic acid.
| Compound Name | (1R,2R)-1-[carboxy(methoxy)methyl]-2-methoxycyclopent-3-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 22884879 |
| Molecular Formula | C10H14O6 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | (1R,2R)-1-[carboxy(methoxy)methyl]-2-methoxycyclopent-3-ene-1-carboxylic acid |
| SMILES | COC(C(=O)O)[C@@]1(C(=O)O)CC=C[C@H]1OC |
| InChI | InChI=1S/C10H14O6/c1-15-6-4-3-5-10(6,9(13)14)7(16-2)8(11)12/h3-4,6-7H,5H2,1-2H3,(H,11,12)(H,13,14)/t6-,7?,10-/m1/s1 |
| InChIKey | LEIYHSWRNZCUGJ-IROMYEEYSA-N |
| XLogP | 0.13 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|