C21H37NO2Si2 — CID 102184864
(4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,3,4-trimethylpyrrolidin-2-one (PubChem CID 102184864) has the molecular formula C21H37NO2Si2 and a molecular weight of 391.70 g/mol. Its IUPAC name is (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,3,4-trimethylpyrrolidin-2-one.
| Compound Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,3,4-trimethylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102184864 |
| Molecular Formula | C21H37NO2Si2 |
| Molecular Weight | 391.70 g/mol |
| Exact Mass | 391.24 |
| IUPAC Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-3,3,4-trimethylpyrrolidin-2-one |
| SMILES | CC1(C)C(=O)N[C@H](O[Si](C)(C)C(C)(C)C)[C@@]1(C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H37NO2Si2/c1-19(2,3)26(9,10)24-18-21(6,20(4,5)17(23)22-18)25(7,8)16-14-12-11-13-15-16/h11-15,18H,1-10H3,(H,22,23)/t18-,21-/m1/s1 |
| InChIKey | OFYWDOSCWDNWMZ-WIYYLYMNSA-N |
| XLogP | 4.87 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.70 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|