C19H33NO2Si2 — CID 102184861
(4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-methylpyrrolidin-2-one (PubChem CID 102184861) has the molecular formula C19H33NO2Si2 and a molecular weight of 363.65 g/mol. Its IUPAC name is (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-methylpyrrolidin-2-one.
| Compound Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-methylpyrrolidin-2-one |
|---|---|
| PubChem CID | 102184861 |
| Molecular Formula | C19H33NO2Si2 |
| Molecular Weight | 363.65 g/mol |
| Exact Mass | 363.20 |
| IUPAC Name | (4S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-4-[dimethyl(phenyl)silyl]-4-methylpyrrolidin-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1NC(=O)C[C@]1(C)[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C19H33NO2Si2/c1-18(2,3)24(7,8)22-17-19(4,14-16(21)20-17)23(5,6)15-12-10-9-11-13-15/h9-13,17H,14H2,1-8H3,(H,20,21)/t17-,19+/m1/s1 |
| InChIKey | YLZZOODELDCMFI-MJGOQNOKSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.65 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|