C18H33NO3 — CID 102186333
methyl (4S,5S)-5-tert-butyl-3-nonyl-4,5-dihydro-1,2-oxazole-4-carboxylate (PubChem CID 102186333) has the molecular formula C18H33NO3 and a molecular weight of 311.47 g/mol. Its IUPAC name is methyl (4S,5S)-5-tert-butyl-3-nonyl-4,5-dihydro-1,2-oxazole-4-carboxylate.
| Compound Name | methyl (4S,5S)-5-tert-butyl-3-nonyl-4,5-dihydro-1,2-oxazole-4-carboxylate |
|---|---|
| PubChem CID | 102186333 |
| Molecular Formula | C18H33NO3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.25 |
| IUPAC Name | methyl (4S,5S)-5-tert-butyl-3-nonyl-4,5-dihydro-1,2-oxazole-4-carboxylate |
| SMILES | CCCCCCCCCC1=NO[C@H](C(C)(C)C)[C@H]1C(=O)OC |
| InChI | InChI=1S/C18H33NO3/c1-6-7-8-9-10-11-12-13-14-15(17(20)21-5)16(22-19-14)18(2,3)4/h15-16H,6-13H2,1-5H3/t15-,16-/m0/s1 |
| InChIKey | UHHZIACYRPTQNK-HOTGVXAUSA-N |
| XLogP | 4.72 |
| TPSA | 47.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|