C18H28O2 — CID 102187216
[(2S)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-yn-2-yl] 2,2-dimethylpropanoate (PubChem CID 102187216) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is [(2S)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-yn-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [(2S)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-yn-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102187216 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | [(2S)-1-(2,6,6-trimethylcyclohexen-1-yl)but-3-yn-2-yl] 2,2-dimethylpropanoate |
| SMILES | C#C[C@H](CC1=C(C)CCCC1(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C18H28O2/c1-8-14(20-16(19)17(3,4)5)12-15-13(2)10-9-11-18(15,6)7/h1,14H,9-12H2,2-7H3/t14-/m1/s1 |
| InChIKey | NLSHXIAGPSTZDP-CQSZACIVSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|