C18H28O3 — CID 19736366
[4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-ynyl] acetate (PubChem CID 19736366) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is [4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-ynyl] acetate.
| Compound Name | [4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-ynyl] acetate |
|---|---|
| PubChem CID | 19736366 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | [4-hydroxy-4-methyl-6-(2,6,6-trimethylcyclohexen-1-yl)hex-2-ynyl] acetate |
| SMILES | CC(=O)OCC#CC(C)(O)CCC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C18H28O3/c1-14-8-6-10-17(3,4)16(14)9-12-18(5,20)11-7-13-21-15(2)19/h20H,6,8-10,12-13H2,1-5H3 |
| InChIKey | AOQMXNFDALHSIC-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|