C13H22O3 — CID 10585343
[(1R)-4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-yl] acetate (PubChem CID 10585343) has the molecular formula C13H22O3 and a molecular weight of 226.32 g/mol. Its IUPAC name is [(1R)-4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-yl] acetate.
| Compound Name | [(1R)-4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-yl] acetate |
|---|---|
| PubChem CID | 10585343 |
| Molecular Formula | C13H22O3 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.16 |
| IUPAC Name | [(1R)-4-(2-hydroxyethyl)-3,5,5-trimethylcyclohex-3-en-1-yl] acetate |
| SMILES | CC(=O)O[C@@H]1CC(C)=C(CCO)C(C)(C)C1 |
| InChI | InChI=1S/C13H22O3/c1-9-7-11(16-10(2)15)8-13(3,4)12(9)5-6-14/h11,14H,5-8H2,1-4H3/t11-/m1/s1 |
| InChIKey | IAVUASATLVKGJZ-LLVKDONJSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|