C19H27F3O5 — CID 102187613
(1R,4S,5R,8S,10R,12R,13R)-1,5-dimethyl-9-methylidene-10-propan-2-yloxy-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane (PubChem CID 102187613) has the molecular formula C19H27F3O5 and a molecular weight of 392.41 g/mol. Its IUPAC name is (1R,4S,5R,8S,10R,12R,13R)-1,5-dimethyl-9-methylidene-10-propan-2-yloxy-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane.
| Compound Name | (1R,4S,5R,8S,10R,12R,13R)-1,5-dimethyl-9-methylidene-10-propan-2-yloxy-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
|---|---|
| PubChem CID | 102187613 |
| Molecular Formula | C19H27F3O5 |
| Molecular Weight | 392.41 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (1R,4S,5R,8S,10R,12R,13R)-1,5-dimethyl-9-methylidene-10-propan-2-yloxy-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadecane |
| SMILES | C=C1[C@@H]2CC[C@@H](C)[C@@H]3CC[C@@]4(C)OO[C@@]23[C@@H](O4)O[C@@]1(OC(C)C)C(F)(F)F |
| InChI | InChI=1S/C19H27F3O5/c1-10(2)23-18(19(20,21)22)12(4)14-7-6-11(3)13-8-9-16(5)24-15(25-18)17(13,14)27-26-16/h10-11,13-15H,4,6-9H2,1-3,5H3/t11-,13+,14+,15+,16-,17-,18-/m1/s1 |
| InChIKey | ZILUEAHKEVVSHK-BKVDKFKQSA-N |
| XLogP | 4.47 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.41 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|