C16H22F3NO4 — CID 146927018
[(1R,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methanamine (PubChem CID 146927018) has the molecular formula C16H22F3NO4 and a molecular weight of 349.35 g/mol. Its IUPAC name is [(1R,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methanamine.
| Compound Name | [(1R,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methanamine |
|---|---|
| PubChem CID | 146927018 |
| Molecular Formula | C16H22F3NO4 |
| Molecular Weight | 349.35 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | [(1R,5R,8S,12R,13R)-1,5-dimethyl-10-(trifluoromethyl)-11,14,15,16-tetraoxatetracyclo[10.3.1.04,13.08,13]hexadec-9-en-9-yl]methanamine |
| SMILES | C[C@@H]1CC[C@H]2C(CN)=C(C(F)(F)F)O[C@@H]3O[C@@]4(C)CCC1[C@]32OO4 |
| InChI | InChI=1S/C16H22F3NO4/c1-8-3-4-11-9(7-20)12(16(17,18)19)21-13-15(11)10(8)5-6-14(2,22-13)23-24-15/h8,10-11,13H,3-7,20H2,1-2H3/t8-,10?,11+,13-,14-,15-/m1/s1 |
| InChIKey | AEGUSMIAYHPVLD-CYUPAICHSA-N |
| XLogP | 3.01 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|